C12H12O5 — CID 139588572
(3aS,4R,5S,7aR)-4,5-dihydroxy-6-(3-methylbut-3-en-1-ynyl)-3a,4,5,7a-tetrahydro-1,3-benzodioxol-2-one (PubChem CID 139588572) has the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. Its IUPAC name is (3aS,4R,5S,7aR)-4,5-dihydroxy-6-(3-methylbut-3-en-1-ynyl)-3a,4,5,7a-tetrahydro-1,3-benzodioxol-2-one.
| Compound Name | (3aS,4R,5S,7aR)-4,5-dihydroxy-6-(3-methylbut-3-en-1-ynyl)-3a,4,5,7a-tetrahydro-1,3-benzodioxol-2-one |
|---|---|
| PubChem CID | 139588572 |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | (3aS,4R,5S,7aR)-4,5-dihydroxy-6-(3-methylbut-3-en-1-ynyl)-3a,4,5,7a-tetrahydro-1,3-benzodioxol-2-one |
| SMILES | C=C(C)C#CC1=C[C@H]2OC(=O)O[C@H]2[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H12O5/c1-6(2)3-4-7-5-8-11(10(14)9(7)13)17-12(15)16-8/h5,8-11,13-14H,1H2,2H3/t8-,9+,10-,11-/m1/s1 |
| InChIKey | OFNHXQSEJLXFQB-LMLFDSFASA-N |
| XLogP | 0.13 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|