C19H21NO4 — CID 139588610
(2R)-2-[(E)-but-2-en-2-yl]-3,3-bis(hydroxymethyl)-5-phenyl-2,7-dihydrofuro[2,3-b]pyridin-4-one (PubChem CID 139588610) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is (2R)-2-[(E)-but-2-en-2-yl]-3,3-bis(hydroxymethyl)-5-phenyl-2,7-dihydrofuro[2,3-b]pyridin-4-one.
| Compound Name | (2R)-2-[(E)-but-2-en-2-yl]-3,3-bis(hydroxymethyl)-5-phenyl-2,7-dihydrofuro[2,3-b]pyridin-4-one |
|---|---|
| PubChem CID | 139588610 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (2R)-2-[(E)-but-2-en-2-yl]-3,3-bis(hydroxymethyl)-5-phenyl-2,7-dihydrofuro[2,3-b]pyridin-4-one |
| SMILES | C/C=C(\C)[C@H]1Oc2[nH]cc(-c3ccccc3)c(=O)c2C1(CO)CO |
| InChI | InChI=1S/C19H21NO4/c1-3-12(2)17-19(10-21,11-22)15-16(23)14(9-20-18(15)24-17)13-7-5-4-6-8-13/h3-9,17,21-22H,10-11H2,1-2H3,(H,20,23)/b12-3+/t17-/m1/s1 |
| InChIKey | FKZNPCVXRTWCQK-SHDNAJFMSA-N |
| XLogP | 1.99 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|