C25H32O5 — CID 139590020
[(1R,2S,7R,8aR)-7-hydroxy-1,8a-dimethyl-6-oxo-7-(3-oxoprop-1-en-2-yl)-2,8-dihydro-1H-naphthalen-2-yl] (2E,4E,6S)-4,6-dimethylocta-2,4-dienoate (PubChem CID 139590020) has the molecular formula C25H32O5 and a molecular weight of 412.53 g/mol. Its IUPAC name is [(1R,2S,7R,8aR)-7-hydroxy-1,8a-dimethyl-6-oxo-7-(3-oxoprop-1-en-2-yl)-2,8-dihydro-1H-naphthalen-2-yl] (2E,4E,6S)-4,6-dimethylocta-2,4-dienoate.
| Compound Name | [(1R,2S,7R,8aR)-7-hydroxy-1,8a-dimethyl-6-oxo-7-(3-oxoprop-1-en-2-yl)-2,8-dihydro-1H-naphthalen-2-yl] (2E,4E,6S)-4,6-dimethylocta-2,4-dienoate |
|---|---|
| PubChem CID | 139590020 |
| Molecular Formula | C25H32O5 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | [(1R,2S,7R,8aR)-7-hydroxy-1,8a-dimethyl-6-oxo-7-(3-oxoprop-1-en-2-yl)-2,8-dihydro-1H-naphthalen-2-yl] (2E,4E,6S)-4,6-dimethylocta-2,4-dienoate |
| SMILES | C=C(C=O)[C@]1(O)C[C@@]2(C)C(=CC1=O)C=C[C@H](OC(=O)/C=C/C(C)=C/[C@@H](C)CC)[C@@H]2C |
| InChI | InChI=1S/C25H32O5/c1-7-16(2)12-17(3)8-11-23(28)30-21-10-9-20-13-22(27)25(29,18(4)14-26)15-24(20,6)19(21)5/h8-14,16,19,21,29H,4,7,15H2,1-3,5-6H3/b11-8+,17-12+/t16-,19-,21-,24+,25+/m0/s1 |
| InChIKey | DPMXZAGDKLVQHB-SSTGVLRWSA-N |
| XLogP | 4.04 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|