C24H35NO5 — CID 139590066
(1S,6R,9E,11S,14S,15R,16S)-6-hydroxy-13-(hydroxymethyl)-9,14-dimethyl-16-(2-methylpropyl)-17-azatricyclo[9.7.0.01,15]octadeca-9,12-diene-2,5,18-trione (PubChem CID 139590066) has the molecular formula C24H35NO5 and a molecular weight of 417.55 g/mol. Its IUPAC name is (1S,6R,9E,11S,14S,15R,16S)-6-hydroxy-13-(hydroxymethyl)-9,14-dimethyl-16-(2-methylpropyl)-17-azatricyclo[9.7.0.01,15]octadeca-9,12-diene-2,5,18-trione.
| Compound Name | (1S,6R,9E,11S,14S,15R,16S)-6-hydroxy-13-(hydroxymethyl)-9,14-dimethyl-16-(2-methylpropyl)-17-azatricyclo[9.7.0.01,15]octadeca-9,12-diene-2,5,18-trione |
|---|---|
| PubChem CID | 139590066 |
| Molecular Formula | C24H35NO5 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | (1S,6R,9E,11S,14S,15R,16S)-6-hydroxy-13-(hydroxymethyl)-9,14-dimethyl-16-(2-methylpropyl)-17-azatricyclo[9.7.0.01,15]octadeca-9,12-diene-2,5,18-trione |
| SMILES | C/C1=C\[C@H]2C=C(CO)[C@@H](C)[C@H]3[C@H](CC(C)C)NC(=O)[C@]32C(=O)CCC(=O)[C@H](O)CC1 |
| InChI | InChI=1S/C24H35NO5/c1-13(2)9-18-22-15(4)16(12-26)11-17-10-14(3)5-6-19(27)20(28)7-8-21(29)24(17,22)23(30)25-18/h10-11,13,15,17-19,22,26-27H,5-9,12H2,1-4H3,(H,25,30)/b14-10+/t15-,17+,18+,19-,22+,24-/m1/s1 |
| InChIKey | MDNVJNHIHGAMFS-AWWBBXBPSA-N |
| XLogP | 2.34 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|