C30H42O7 — CID 139590871
Spiroganocalitone B (PubChem CID 139590871) has the molecular formula C30H42O7 and a molecular weight of 514.66 g/mol.
| Compound Name | Spiroganocalitone B |
|---|---|
| PubChem CID | 139590871 |
| Molecular Formula | C30H42O7 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | — |
| SMILES | C[C@@H]1C[C@]2(C[C@H](C)C(=O)O2)O[C@@]12C[C@H](O)[C@@]1(C)C3=C(C(=O)C[C@]21C)[C@@]1(C)CCC(=O)C(C)(C)[C@@H]1C[C@@H]3O |
| InChI | InChI=1S/C30H42O7/c1-15-11-29(36-24(15)35)12-16(2)30(37-29)14-21(34)28(7)23-17(31)10-19-25(3,4)20(33)8-9-26(19,5)22(23)18(32)13-27(28,30)6/h15-17,19,21,31,34H,8-14H2,1-7H3/t15-,16+,17-,19-,21-,26-,27-,28-,29-,30-/m0/s1 |
| InChIKey | CTBUPPQPICQVQX-XDXZQEKDSA-N |
| XLogP | 3.88 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |