C31H46O6 — CID 163015654
7-(7,15-dihydroxy-4,4,10,13,14-pentamethyl-3,11-dioxo-2,5,6,7,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl)-3-methyl-5-oxooctanal (PubChem CID 163015654) has the molecular formula C31H46O6 and a molecular weight of 514.70 g/mol. Its IUPAC name is 7-(7,15-dihydroxy-4,4,10,13,14-pentamethyl-3,11-dioxo-2,5,6,7,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl)-3-methyl-5-oxooctanal.
| Compound Name | 7-(7,15-dihydroxy-4,4,10,13,14-pentamethyl-3,11-dioxo-2,5,6,7,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl)-3-methyl-5-oxooctanal |
|---|---|
| PubChem CID | 163015654 |
| Molecular Formula | C31H46O6 |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | 7-(7,15-dihydroxy-4,4,10,13,14-pentamethyl-3,11-dioxo-2,5,6,7,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl)-3-methyl-5-oxooctanal |
| SMILES | CC(CC=O)CC(=O)CC(C)C1CC(O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3O |
| InChI | InChI=1S/C31H46O6/c1-17(9-11-32)12-19(33)13-18(2)20-14-25(37)31(7)27-21(34)15-23-28(3,4)24(36)8-10-29(23,5)26(27)22(35)16-30(20,31)6/h11,17-18,20-21,23,25,34,37H,8-10,12-16H2,1-7H3 |
| InChIKey | VQORVNSWBFOFFP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|