C34H52O7 — CID 163100871
6-[7,15-dihydroxy-4,10,13,14-tetramethyl-4-(3-methylbutyl)-3,11-dioxo-2,5,6,7,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-hydroxy-2-methylhept-2-enoic acid (PubChem CID 163100871) has the molecular formula C34H52O7 and a molecular weight of 572.78 g/mol. Its IUPAC name is 6-[7,15-dihydroxy-4,10,13,14-tetramethyl-4-(3-methylbutyl)-3,11-dioxo-2,5,6,7,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-hydroxy-2-methylhept-2-enoic acid.
| Compound Name | 6-[7,15-dihydroxy-4,10,13,14-tetramethyl-4-(3-methylbutyl)-3,11-dioxo-2,5,6,7,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-hydroxy-2-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 163100871 |
| Molecular Formula | C34H52O7 |
| Molecular Weight | 572.78 g/mol |
| Exact Mass | 572.37 |
| IUPAC Name | 6-[7,15-dihydroxy-4,10,13,14-tetramethyl-4-(3-methylbutyl)-3,11-dioxo-2,5,6,7,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-hydroxy-2-methylhept-2-enoic acid |
| SMILES | CC(=CC(O)CC(C)C1CC(O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(CCC(C)C)C1CC3O)C(=O)O |
| InChI | InChI=1S/C34H52O7/c1-18(2)9-11-31(5)25-16-23(36)29-28(32(25,6)12-10-26(31)38)24(37)17-33(7)22(15-27(39)34(29,33)8)19(3)13-21(35)14-20(4)30(40)41/h14,18-19,21-23,25,27,35-36,39H,9-13,15-17H2,1-8H3,(H,40,41) |
| InChIKey | XKMHVMGSXYJFCA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.78 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|