C33H44O7 — CID 162839356
6-(14,22-dihydroxy-7,11,19-trimethyl-8,17-dioxo-20-pentacyclo[13.7.0.01,19.07,12.011,16]docos-15-en-4-ynyl)-4-hydroxy-2-methylhept-2-enoic acid (PubChem CID 162839356) has the molecular formula C33H44O7 and a molecular weight of 552.71 g/mol. Its IUPAC name is 6-(14,22-dihydroxy-7,11,19-trimethyl-8,17-dioxo-20-pentacyclo[13.7.0.01,19.07,12.011,16]docos-15-en-4-ynyl)-4-hydroxy-2-methylhept-2-enoic acid.
| Compound Name | 6-(14,22-dihydroxy-7,11,19-trimethyl-8,17-dioxo-20-pentacyclo[13.7.0.01,19.07,12.011,16]docos-15-en-4-ynyl)-4-hydroxy-2-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 162839356 |
| Molecular Formula | C33H44O7 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | 6-(14,22-dihydroxy-7,11,19-trimethyl-8,17-dioxo-20-pentacyclo[13.7.0.01,19.07,12.011,16]docos-15-en-4-ynyl)-4-hydroxy-2-methylhept-2-enoic acid |
| SMILES | CC(=CC(O)CC(C)C1CC(O)C23CCC#CCC4(C)C(=O)CCC5(C)C(=C2C(O)CC45)C(=O)CC13C)C(=O)O |
| InChI | InChI=1S/C33H44O7/c1-18(13-20(34)14-19(2)29(39)40)21-15-26(38)33-11-8-6-7-10-30(3)24-16-22(35)28(33)27(23(36)17-32(21,33)5)31(24,4)12-9-25(30)37/h14,18,20-22,24,26,34-35,38H,8-13,15-17H2,1-5H3,(H,39,40) |
| InChIKey | BVYATMFPWLZNNM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|