C31H46O8 — CID 162838632
6-[7,15-dihydroxy-14-(2-hydroxyethyl)-4,4,10,13-tetramethyl-3,11-dioxo-2,5,6,7,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-hydroxy-2-methylhept-2-enoic acid (PubChem CID 162838632) has the molecular formula C31H46O8 and a molecular weight of 546.70 g/mol. Its IUPAC name is 6-[7,15-dihydroxy-14-(2-hydroxyethyl)-4,4,10,13-tetramethyl-3,11-dioxo-2,5,6,7,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-hydroxy-2-methylhept-2-enoic acid.
| Compound Name | 6-[7,15-dihydroxy-14-(2-hydroxyethyl)-4,4,10,13-tetramethyl-3,11-dioxo-2,5,6,7,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-hydroxy-2-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 162838632 |
| Molecular Formula | C31H46O8 |
| Molecular Weight | 546.70 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | 6-[7,15-dihydroxy-14-(2-hydroxyethyl)-4,4,10,13-tetramethyl-3,11-dioxo-2,5,6,7,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-hydroxy-2-methylhept-2-enoic acid |
| SMILES | CC(=CC(O)CC(C)C1CC(O)C2(CCO)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3O)C(=O)O |
| InChI | InChI=1S/C31H46O8/c1-16(11-18(33)12-17(2)27(38)39)19-13-24(37)31(9-10-32)26-20(34)14-22-28(3,4)23(36)7-8-29(22,5)25(26)21(35)15-30(19,31)6/h12,16,18-20,22,24,32-34,37H,7-11,13-15H2,1-6H3,(H,38,39) |
| InChIKey | JEDUWPFSQPDBJH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.70 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|