C22H24N2O2 — CID 139593043
8,9-dimethoxy-3-phenyl-1-propyl-5,6-dihydroimidazo[5,1-a]isoquinoline (PubChem CID 139593043) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 8,9-dimethoxy-3-phenyl-1-propyl-5,6-dihydroimidazo[5,1-a]isoquinoline.
| Compound Name | 8,9-dimethoxy-3-phenyl-1-propyl-5,6-dihydroimidazo[5,1-a]isoquinoline |
|---|---|
| PubChem CID | 139593043 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 8,9-dimethoxy-3-phenyl-1-propyl-5,6-dihydroimidazo[5,1-a]isoquinoline |
| SMILES | CCCc1nc(-c2ccccc2)n2c1-c1cc(OC)c(OC)cc1CC2 |
| InChI | InChI=1S/C22H24N2O2/c1-4-8-18-21-17-14-20(26-3)19(25-2)13-16(17)11-12-24(21)22(23-18)15-9-6-5-7-10-15/h5-7,9-10,13-14H,4,8,11-12H2,1-3H3 |
| InChIKey | LVVOWZVZLCBNBP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |