C21H20N2O6 — CID 12012977
2,3,8,9-tetramethoxy-11,12-dihydroquinazolino[3,2-c][3]benzazepine-6,14-dione (PubChem CID 12012977) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is 2,3,8,9-tetramethoxy-11,12-dihydroquinazolino[3,2-c][3]benzazepine-6,14-dione.
| Compound Name | 2,3,8,9-tetramethoxy-11,12-dihydroquinazolino[3,2-c][3]benzazepine-6,14-dione |
|---|---|
| PubChem CID | 12012977 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2,3,8,9-tetramethoxy-11,12-dihydroquinazolino[3,2-c][3]benzazepine-6,14-dione |
| SMILES | COc1cc2c(cc1OC)C(=O)c1nc3cc(OC)c(OC)cc3c(=O)n1CC2 |
| InChI | InChI=1S/C21H20N2O6/c1-26-15-7-11-5-6-23-20(19(24)12(11)8-16(15)27-2)22-14-10-18(29-4)17(28-3)9-13(14)21(23)25/h7-10H,5-6H2,1-4H3 |
| InChIKey | OGCOYBKRNGYFLW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 88.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |