C22H25N3O4 — CID 92596034
8,9-dimethoxy-3-[(4-methoxyphenyl)methyl]-1,2,4,5-tetrahydro-[1,4]diazepino[7,1-b]quinazolin-11-one (PubChem CID 92596034) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 8,9-dimethoxy-3-[(4-methoxyphenyl)methyl]-1,2,4,5-tetrahydro-[1,4]diazepino[7,1-b]quinazolin-11-one.
| Compound Name | 8,9-dimethoxy-3-[(4-methoxyphenyl)methyl]-1,2,4,5-tetrahydro-[1,4]diazepino[7,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 92596034 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 8,9-dimethoxy-3-[(4-methoxyphenyl)methyl]-1,2,4,5-tetrahydro-[1,4]diazepino[7,1-b]quinazolin-11-one |
| SMILES | COc1ccc(CN2CCc3nc4cc(OC)c(OC)cc4c(=O)n3CC2)cc1 |
| InChI | InChI=1S/C22H25N3O4/c1-27-16-6-4-15(5-7-16)14-24-9-8-21-23-18-13-20(29-3)19(28-2)12-17(18)22(26)25(21)11-10-24/h4-7,12-13H,8-11,14H2,1-3H3 |
| InChIKey | FJFYJDPWUVLAHU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |