C18H17F4N3O2 — CID 139593251
cyclopropyl N-[2-amino-3-fluoro-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]carbamate (PubChem CID 139593251) has the molecular formula C18H17F4N3O2 and a molecular weight of 383.35 g/mol. Its IUPAC name is cyclopropyl N-[2-amino-3-fluoro-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]carbamate.
| Compound Name | cyclopropyl N-[2-amino-3-fluoro-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 139593251 |
| Molecular Formula | C18H17F4N3O2 |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | cyclopropyl N-[2-amino-3-fluoro-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]carbamate |
| SMILES | Nc1c(NC(=O)OC2CC2)ccc(NCc2ccc(C(F)(F)F)cc2)c1F |
| InChI | InChI=1S/C18H17F4N3O2/c19-15-13(24-9-10-1-3-11(4-2-10)18(20,21)22)7-8-14(16(15)23)25-17(26)27-12-5-6-12/h1-4,7-8,12,24H,5-6,9,23H2,(H,25,26) |
| InChIKey | ABYIXDBMGLFCSO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|