C24H26N2O5 — CID 1395949
(2R)-N-(4-ethoxyphenyl)-N-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]oxolane-2-carboxamide (PubChem CID 1395949) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is (2R)-N-(4-ethoxyphenyl)-N-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]oxolane-2-carboxamide.
| Compound Name | (2R)-N-(4-ethoxyphenyl)-N-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 1395949 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (2R)-N-(4-ethoxyphenyl)-N-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]oxolane-2-carboxamide |
| SMILES | CCOc1ccc(N(Cc2cc3cc(OC)ccc3[nH]c2=O)C(=O)[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C24H26N2O5/c1-3-30-19-8-6-18(7-9-19)26(24(28)22-5-4-12-31-22)15-17-13-16-14-20(29-2)10-11-21(16)25-23(17)27/h6-11,13-14,22H,3-5,12,15H2,1-2H3,(H,25,27)/t22-/m1/s1 |
| InChIKey | ZYBKBENVFFGRAH-JOCHJYFZSA-N |
| XLogP | 3.65 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |