C10H14N2O4S — CID 139595012
[5-(1-methylpyrrolidin-2-yl)-3-pyridinyl] hydrogen sulfate (PubChem CID 139595012) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is [5-(1-methylpyrrolidin-2-yl)-3-pyridinyl] hydrogen sulfate.
| Compound Name | [5-(1-methylpyrrolidin-2-yl)-3-pyridinyl] hydrogen sulfate |
|---|---|
| PubChem CID | 139595012 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | [5-(1-methylpyrrolidin-2-yl)-3-pyridinyl] hydrogen sulfate |
| SMILES | CN1CCCC1c1cncc(OS(=O)(=O)O)c1 |
| InChI | InChI=1S/C10H14N2O4S/c1-12-4-2-3-10(12)8-5-9(7-11-6-8)16-17(13,14)15/h5-7,10H,2-4H2,1H3,(H,13,14,15) |
| InChIKey | GAARMTUCEIDIOT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|