C10H14CuN2O4S — CID 158251825
copper;3-(1-methylpyrrolidin-2-yl)pyridine;sulfate (PubChem CID 158251825) has the molecular formula C10H14CuN2O4S and a molecular weight of 321.84 g/mol. Its IUPAC name is copper;3-(1-methylpyrrolidin-2-yl)pyridine;sulfate.
| Compound Name | copper;3-(1-methylpyrrolidin-2-yl)pyridine;sulfate |
|---|---|
| PubChem CID | 158251825 |
| Molecular Formula | C10H14CuN2O4S |
| Molecular Weight | 321.84 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | copper;3-(1-methylpyrrolidin-2-yl)pyridine;sulfate |
| SMILES | CN1CCCC1c1cccnc1.O=S(=O)([O-])[O-].[Cu+2] |
| InChI | InChI=1S/C10H14N2.Cu.H2O4S/c1-12-7-3-5-10(12)9-4-2-6-11-8-9;;1-5(2,3)4/h2,4,6,8,10H,3,5,7H2,1H3;;(H2,1,2,3,4)/q;+2;/p-2 |
| InChIKey | GGUQUHCOQGMGNM-UHFFFAOYSA-L |
| XLogP | 0.51 |
| TPSA | 96.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.84 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|