C15H20O5S — CID 139595212
4-(4-methyl-6-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl)butanoic acid (PubChem CID 139595212) has the molecular formula C15H20O5S and a molecular weight of 312.39 g/mol. Its IUPAC name is 4-(4-methyl-6-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl)butanoic acid.
| Compound Name | 4-(4-methyl-6-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl)butanoic acid |
|---|---|
| PubChem CID | 139595212 |
| Molecular Formula | C15H20O5S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 4-(4-methyl-6-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl)butanoic acid |
| SMILES | CC1CCC(CCCC(=O)O)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C15H20O5S/c1-10-5-6-11(3-2-4-15(16)17)13-8-7-12(9-14(10)13)21(18,19)20/h7-11H,2-6H2,1H3,(H,16,17)(H,18,19,20) |
| InChIKey | HFAMWNAXSCOTRZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|