C20H26CaO5S — CID 3070412
calcium (1R,4aR,10aS)-1,4a-dimethyl-7-propan-2-yl-6-sulfonato-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 3070412) has the molecular formula C20H26CaO5S and a molecular weight of 418.57 g/mol. Its IUPAC name is calcium (1R,4aR,10aS)-1,4a-dimethyl-7-propan-2-yl-6-sulfonato-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | calcium (1R,4aR,10aS)-1,4a-dimethyl-7-propan-2-yl-6-sulfonato-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 3070412 |
| Molecular Formula | C20H26CaO5S |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | calcium (1R,4aR,10aS)-1,4a-dimethyl-7-propan-2-yl-6-sulfonato-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | CC(C)c1cc2c(cc1S(=O)(=O)[O-])[C@]1(C)CCC[C@@](C)(C(=O)[O-])[C@H]1CC2.[Ca+2] |
| InChI | InChI=1S/C20H28O5S.Ca/c1-12(2)14-10-13-6-7-17-19(3,8-5-9-20(17,4)18(21)22)15(13)11-16(14)26(23,24)25;/h10-12,17H,5-9H2,1-4H3,(H,21,22)(H,23,24,25);/q;+2/p-2/t17-,19-,20+;/m0./s1 |
| InChIKey | ARDPVXCPTNGYGN-PQRDQDNSSA-L |
| XLogP | 2.09 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|