C21H28NO5P-2 — CID 139596027
1-[1-(2-benzylphenoxy)propan-2-yl]piperidin-1-ium phosphate (PubChem CID 139596027) has the molecular formula C21H28NO5P-2 and a molecular weight of 405.43 g/mol. Its IUPAC name is 1-[1-(2-benzylphenoxy)propan-2-yl]piperidin-1-ium phosphate.
| Compound Name | 1-[1-(2-benzylphenoxy)propan-2-yl]piperidin-1-ium phosphate |
|---|---|
| PubChem CID | 139596027 |
| Molecular Formula | C21H28NO5P-2 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 1-[1-(2-benzylphenoxy)propan-2-yl]piperidin-1-ium phosphate |
| SMILES | CC(COc1ccccc1Cc1ccccc1)[NH+]1CCCCC1.O=P([O-])([O-])[O-] |
| InChI | InChI=1S/C21H27NO.H3O4P/c1-18(22-14-8-3-9-15-22)17-23-21-13-7-6-12-20(21)16-19-10-4-2-5-11-19;1-5(2,3)4/h2,4-7,10-13,18H,3,8-9,14-17H2,1H3;(H3,1,2,3,4)/p-2 |
| InChIKey | MCVUURBOSHQXMK-UHFFFAOYSA-L |
| XLogP | 0.29 |
| TPSA | 99.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|