C21H30NO5P — CID 76969563
1-[(2R)-1-(2-benzylphenoxy)propan-2-yl]piperidine;phosphoric acid (PubChem CID 76969563) has the molecular formula C21H30NO5P and a molecular weight of 407.45 g/mol. Its IUPAC name is 1-[(2R)-1-(2-benzylphenoxy)propan-2-yl]piperidine;phosphoric acid.
| Compound Name | 1-[(2R)-1-(2-benzylphenoxy)propan-2-yl]piperidine;phosphoric acid |
|---|---|
| PubChem CID | 76969563 |
| Molecular Formula | C21H30NO5P |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 1-[(2R)-1-(2-benzylphenoxy)propan-2-yl]piperidine;phosphoric acid |
| SMILES | C[C@H](COc1ccccc1Cc1ccccc1)N1CCCCC1.O=P(O)(O)O |
| InChI | InChI=1S/C21H27NO.H3O4P/c1-18(22-14-8-3-9-15-22)17-23-21-13-7-6-12-20(21)16-19-10-4-2-5-11-19;1-5(2,3)4/h2,4-7,10-13,18H,3,8-9,14-17H2,1H3;(H3,1,2,3,4)/t18-;/m1./s1 |
| InChIKey | MCVUURBOSHQXMK-GMUIIQOCSA-N |
| XLogP | 3.60 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|