About trisodium;(2S)-2-[bis(carboxymethyl)amino]propanoic acid
trisodium;(2S)-2-[bis(carboxymethyl)amino]propanoic acid (PubChem CID 139596400) has the molecular formula C7H11NNa3O6+3
and a molecular weight of 274.14 g/mol. Its IUPAC name is trisodium;(2S)-2-[bis(carboxymethyl)amino]propanoic acid.
Molecular Properties
| Compound Name | trisodium;(2S)-2-[bis(carboxymethyl)amino]propanoic acid |
| PubChem CID | 139596400 |
| Molecular Formula | C7H11NNa3O6+3 |
| Molecular Weight | 274.14 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | trisodium;(2S)-2-[bis(carboxymethyl)amino]propanoic acid |
| SMILES | C[C@@H](C(=O)O)N(CC(=O)O)CC(=O)O.[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C7H11NO6.3Na/c1-4(7(13)14)8(2-5(9)10)3-6(11)12;;;/h4H,2-3H2,1H3,(H,9,10)(H,11,12)(H,13,14);;;/q;3*+1/t4-;;;/m0.../s1 |
| InChIKey | OHOTVSOGTVKXEL-WJXVXWFNSA-N |
| XLogP | -10.06 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.14 |
| LogP ≤ 5 | -10.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze trisodium;(2S)-2-[bis(carboxymethyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;(2S)-2-[bis(carboxymethyl)amino]propanoic acid?
The IUPAC name of trisodium;(2S)-2-[bis(carboxymethyl)amino]propanoic acid (CID 139596400) is trisodium;(2S)-2-[bis(carboxymethyl)amino]propanoic acid.
What is the SMILES notation for trisodium;(2S)-2-[bis(carboxymethyl)amino]propanoic acid?
The canonical SMILES for trisodium;(2S)-2-[bis(carboxymethyl)amino]propanoic acid is C[C@@H](C(=O)O)N(CC(=O)O)CC(=O)O.[Na+].[Na+].[Na+].
What is the InChIKey of trisodium;(2S)-2-[bis(carboxymethyl)amino]propanoic acid?
The InChIKey is OHOTVSOGTVKXEL-WJXVXWFNSA-N. The full InChI is InChI=1S/C7H11NO6.3Na/c1-4(7(13)14)8(2-5(9)10)3-6(11)12;;;/h4H,2-3H2,1H3,(H,9,10)(H,11,12)(H,13,14);;;/q;3*+1/t4-;;;/m0.../s1.
What are the key properties of trisodium;(2S)-2-[bis(carboxymethyl)amino]propanoic acid?
trisodium;(2S)-2-[bis(carboxymethyl)amino]propanoic acid has a molecular weight of 274.14 g/mol, XLogP of -10.06, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;(2S)-2-[bis(carboxymethyl)amino]propanoic acid is sourced from PubChem (CID 139596400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).