About disodium;2-[carboxylatomethyl(carboxymethyl)amino]acetate;hydrate
disodium;2-[carboxylatomethyl(carboxymethyl)amino]acetate;hydrate (PubChem CID 21116573) has the molecular formula C6H9NNa2O7
and a molecular weight of 253.12 g/mol. Its IUPAC name is disodium;2-[carboxylatomethyl(carboxymethyl)amino]acetate;hydrate.
Molecular Properties
| Compound Name | disodium;2-[carboxylatomethyl(carboxymethyl)amino]acetate;hydrate |
| PubChem CID | 21116573 |
| Molecular Formula | C6H9NNa2O7 |
| Molecular Weight | 253.12 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | disodium;2-[carboxylatomethyl(carboxymethyl)amino]acetate;hydrate |
| SMILES | O.O=C([O-])CN(CC(=O)[O-])CC(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C6H9NO6.2Na.H2O/c8-4(9)1-7(2-5(10)11)3-6(12)13;;;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);;;1H2/q;2*+1;/p-2 |
| InChIKey | GVFFJAGZCMFNEI-UHFFFAOYSA-L |
| XLogP | -10.94 |
| TPSA | 152.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.12 |
| LogP ≤ 5 | -10.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze disodium;2-[carboxylatomethyl(carboxymethyl)amino]acetate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-[carboxylatomethyl(carboxymethyl)amino]acetate;hydrate?
The IUPAC name of disodium;2-[carboxylatomethyl(carboxymethyl)amino]acetate;hydrate (CID 21116573) is disodium;2-[carboxylatomethyl(carboxymethyl)amino]acetate;hydrate.
What is the SMILES notation for disodium;2-[carboxylatomethyl(carboxymethyl)amino]acetate;hydrate?
The canonical SMILES for disodium;2-[carboxylatomethyl(carboxymethyl)amino]acetate;hydrate is O.O=C([O-])CN(CC(=O)[O-])CC(=O)O.[Na+].[Na+].
What is the InChIKey of disodium;2-[carboxylatomethyl(carboxymethyl)amino]acetate;hydrate?
The InChIKey is GVFFJAGZCMFNEI-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H9NO6.2Na.H2O/c8-4(9)1-7(2-5(10)11)3-6(12)13;;;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);;;1H2/q;2*+1;/p-2.
What are the key properties of disodium;2-[carboxylatomethyl(carboxymethyl)amino]acetate;hydrate?
disodium;2-[carboxylatomethyl(carboxymethyl)amino]acetate;hydrate has a molecular weight of 253.12 g/mol, XLogP of -10.94, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-[carboxylatomethyl(carboxymethyl)amino]acetate;hydrate is sourced from PubChem (CID 21116573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).