C16H15F4NO5 — CID 139598532
(3aR,6aR)-5-[2-(1,1,2,2-tetrafluoroethoxy)benzoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 139598532) has the molecular formula C16H15F4NO5 and a molecular weight of 377.29 g/mol. Its IUPAC name is (3aR,6aR)-5-[2-(1,1,2,2-tetrafluoroethoxy)benzoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-5-[2-(1,1,2,2-tetrafluoroethoxy)benzoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 139598532 |
| Molecular Formula | C16H15F4NO5 |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | (3aR,6aR)-5-[2-(1,1,2,2-tetrafluoroethoxy)benzoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(c1ccccc1OC(F)(F)C(F)F)N1C[C@@H]2COC[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C16H15F4NO5/c17-13(18)16(19,20)26-11-4-2-1-3-10(11)12(22)21-5-9-6-25-8-15(9,7-21)14(23)24/h1-4,9,13H,5-8H2,(H,23,24)/t9-,15-/m1/s1 |
| InChIKey | XJPVTHDYQWVZRY-RFAUZJTJSA-N |
| XLogP | 2.10 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|