C16H15F4N3O4 — CID 95135194
(9aS)-2-[2-(1,1,2,2-tetrafluoroethoxy)benzoyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 95135194) has the molecular formula C16H15F4N3O4 and a molecular weight of 389.31 g/mol. Its IUPAC name is (9aS)-2-[2-(1,1,2,2-tetrafluoroethoxy)benzoyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (9aS)-2-[2-(1,1,2,2-tetrafluoroethoxy)benzoyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 95135194 |
| Molecular Formula | C16H15F4N3O4 |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | (9aS)-2-[2-(1,1,2,2-tetrafluoroethoxy)benzoyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | O=C1NCC(=O)N2CCN(C(=O)c3ccccc3OC(F)(F)C(F)F)C[C@@H]12 |
| InChI | InChI=1S/C16H15F4N3O4/c17-15(18)16(19,20)27-11-4-2-1-3-9(11)14(26)22-5-6-23-10(8-22)13(25)21-7-12(23)24/h1-4,10,15H,5-8H2,(H,21,25)/t10-/m0/s1 |
| InChIKey | IOVVECUCFUQOQQ-JTQLQIEISA-N |
| XLogP | 0.71 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|