C21H16F6N4O2 — CID 74829936
[3-[(6,7-difluoroquinoxalin-2-yl)amino]pyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone (PubChem CID 74829936) has the molecular formula C21H16F6N4O2 and a molecular weight of 470.37 g/mol. Its IUPAC name is [3-[(6,7-difluoroquinoxalin-2-yl)amino]pyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone.
| Compound Name | [3-[(6,7-difluoroquinoxalin-2-yl)amino]pyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 74829936 |
| Molecular Formula | C21H16F6N4O2 |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | [3-[(6,7-difluoroquinoxalin-2-yl)amino]pyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone |
| SMILES | O=C(c1ccccc1OC(F)(F)C(F)F)N1CCC(Nc2cnc3cc(F)c(F)cc3n2)C1 |
| InChI | InChI=1S/C21H16F6N4O2/c22-13-7-15-16(8-14(13)23)30-18(9-28-15)29-11-5-6-31(10-11)19(32)12-3-1-2-4-17(12)33-21(26,27)20(24)25/h1-4,7-9,11,20H,5-6,10H2,(H,29,30) |
| InChIKey | UNANMHZAVGNFLJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|