C20H17F3N4O2 — CID 68972237
[3-(quinoxalin-2-ylamino)pyrrolidin-1-yl]-[2-(trifluoromethoxy)phenyl]methanone (PubChem CID 68972237) has the molecular formula C20H17F3N4O2 and a molecular weight of 402.38 g/mol. Its IUPAC name is [3-(quinoxalin-2-ylamino)pyrrolidin-1-yl]-[2-(trifluoromethoxy)phenyl]methanone.
| Compound Name | [3-(quinoxalin-2-ylamino)pyrrolidin-1-yl]-[2-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 68972237 |
| Molecular Formula | C20H17F3N4O2 |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | [3-(quinoxalin-2-ylamino)pyrrolidin-1-yl]-[2-(trifluoromethoxy)phenyl]methanone |
| SMILES | O=C(c1ccccc1OC(F)(F)F)N1CCC(Nc2cnc3ccccc3n2)C1 |
| InChI | InChI=1S/C20H17F3N4O2/c21-20(22,23)29-17-8-4-1-5-14(17)19(28)27-10-9-13(12-27)25-18-11-24-15-6-2-3-7-16(15)26-18/h1-8,11,13H,9-10,12H2,(H,25,26) |
| InChIKey | CHEOIOGEMSFQAB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |