C21H17ClF4N4O2 — CID 74834650
[3-[(7-chloroquinoxalin-2-yl)amino]pyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone (PubChem CID 74834650) has the molecular formula C21H17ClF4N4O2 and a molecular weight of 468.84 g/mol. Its IUPAC name is [3-[(7-chloroquinoxalin-2-yl)amino]pyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone.
| Compound Name | [3-[(7-chloroquinoxalin-2-yl)amino]pyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 74834650 |
| Molecular Formula | C21H17ClF4N4O2 |
| Molecular Weight | 468.84 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | [3-[(7-chloroquinoxalin-2-yl)amino]pyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone |
| SMILES | O=C(c1ccccc1OC(F)(F)C(F)F)N1CCC(Nc2cnc3ccc(Cl)cc3n2)C1 |
| InChI | InChI=1S/C21H17ClF4N4O2/c22-12-5-6-15-16(9-12)29-18(10-27-15)28-13-7-8-30(11-13)19(31)14-3-1-2-4-17(14)32-21(25,26)20(23)24/h1-6,9-10,13,20H,7-8,11H2,(H,28,29) |
| InChIKey | KLXQRVXBRMTVHI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.84 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|