C22H20ClF4N3O2 — CID 141253333
[(3S)-3-[[(6-chloro-1H-indol-2-yl)amino]methyl]pyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone (PubChem CID 141253333) has the molecular formula C22H20ClF4N3O2 and a molecular weight of 469.87 g/mol. Its IUPAC name is [(3S)-3-[[(6-chloro-1H-indol-2-yl)amino]methyl]pyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone.
| Compound Name | [(3S)-3-[[(6-chloro-1H-indol-2-yl)amino]methyl]pyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 141253333 |
| Molecular Formula | C22H20ClF4N3O2 |
| Molecular Weight | 469.87 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | [(3S)-3-[[(6-chloro-1H-indol-2-yl)amino]methyl]pyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone |
| SMILES | O=C(c1ccccc1OC(F)(F)C(F)F)N1CC[C@@H](CNc2cc3ccc(Cl)cc3[nH]2)C1 |
| InChI | InChI=1S/C22H20ClF4N3O2/c23-15-6-5-14-9-19(29-17(14)10-15)28-11-13-7-8-30(12-13)20(31)16-3-1-2-4-18(16)32-22(26,27)21(24)25/h1-6,9-10,13,21,28-29H,7-8,11-12H2/t13-/m0/s1 |
| InChIKey | OPTQSSYKSWHDJM-ZDUSSCGKSA-N |
| XLogP | 5.63 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.87 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|