C23H20ClN3OS — CID 141358963
[(3R)-3-[(6-chloro-1H-indol-2-yl)amino]pyrrolidin-1-yl]-(2-thiophen-3-ylphenyl)methanone (PubChem CID 141358963) has the molecular formula C23H20ClN3OS and a molecular weight of 421.95 g/mol. Its IUPAC name is [(3R)-3-[(6-chloro-1H-indol-2-yl)amino]pyrrolidin-1-yl]-(2-thiophen-3-ylphenyl)methanone.
| Compound Name | [(3R)-3-[(6-chloro-1H-indol-2-yl)amino]pyrrolidin-1-yl]-(2-thiophen-3-ylphenyl)methanone |
|---|---|
| PubChem CID | 141358963 |
| Molecular Formula | C23H20ClN3OS |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | [(3R)-3-[(6-chloro-1H-indol-2-yl)amino]pyrrolidin-1-yl]-(2-thiophen-3-ylphenyl)methanone |
| SMILES | O=C(c1ccccc1-c1ccsc1)N1CC[C@@H](Nc2cc3ccc(Cl)cc3[nH]2)C1 |
| InChI | InChI=1S/C23H20ClN3OS/c24-17-6-5-15-11-22(26-21(15)12-17)25-18-7-9-27(13-18)23(28)20-4-2-1-3-19(20)16-8-10-29-14-16/h1-6,8,10-12,14,18,25-26H,7,9,13H2/t18-/m1/s1 |
| InChIKey | IHKSCSVXUXJSFN-GOSISDBHSA-N |
| XLogP | 5.88 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |