C16H15Cl2NOS — CID 90522375
(2,4-dichlorophenyl)-(4-thiophen-3-ylpiperidin-1-yl)methanone (PubChem CID 90522375) has the molecular formula C16H15Cl2NOS and a molecular weight of 340.28 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-(4-thiophen-3-ylpiperidin-1-yl)methanone.
| Compound Name | (2,4-dichlorophenyl)-(4-thiophen-3-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 90522375 |
| Molecular Formula | C16H15Cl2NOS |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | (2,4-dichlorophenyl)-(4-thiophen-3-ylpiperidin-1-yl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1Cl)N1CCC(c2ccsc2)CC1 |
| InChI | InChI=1S/C16H15Cl2NOS/c17-13-1-2-14(15(18)9-13)16(20)19-6-3-11(4-7-19)12-5-8-21-10-12/h1-2,5,8-11H,3-4,6-7H2 |
| InChIKey | GXBLWIJJTXJONC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |