C28H30N4O3 — CID 139600197
3-(2,3-dihydroindol-1-yl)-4-[3-[3-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]propyl]indol-1-yl]pyrrole-2,5-dione (PubChem CID 139600197) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-yl)-4-[3-[3-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]propyl]indol-1-yl]pyrrole-2,5-dione.
| Compound Name | 3-(2,3-dihydroindol-1-yl)-4-[3-[3-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]propyl]indol-1-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 139600197 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 3-(2,3-dihydroindol-1-yl)-4-[3-[3-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]propyl]indol-1-yl]pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(n2cc(CCCN3CCC[C@@H]3CO)c3ccccc32)=C1N1CCc2ccccc21 |
| InChI | InChI=1S/C28H30N4O3/c33-18-21-9-6-15-30(21)14-5-8-20-17-32(24-12-4-2-10-22(20)24)26-25(27(34)29-28(26)35)31-16-13-19-7-1-3-11-23(19)31/h1-4,7,10-12,17,21,33H,5-6,8-9,13-16,18H2,(H,29,34,35)/t21-/m1/s1 |
| InChIKey | DYKCRAZWUHVAGV-OAQYLSRUSA-N |
| XLogP | 2.92 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|