C25H23N5O2S — CID 139600189
3-[1-(4-indol-1-yl-2,5-dioxopyrrol-3-yl)indol-3-yl]propyl N'-methylcarbamimidothioate (PubChem CID 139600189) has the molecular formula C25H23N5O2S and a molecular weight of 457.56 g/mol. Its IUPAC name is 3-[1-(4-indol-1-yl-2,5-dioxopyrrol-3-yl)indol-3-yl]propyl N'-methylcarbamimidothioate.
| Compound Name | 3-[1-(4-indol-1-yl-2,5-dioxopyrrol-3-yl)indol-3-yl]propyl N'-methylcarbamimidothioate |
|---|---|
| PubChem CID | 139600189 |
| Molecular Formula | C25H23N5O2S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 3-[1-(4-indol-1-yl-2,5-dioxopyrrol-3-yl)indol-3-yl]propyl N'-methylcarbamimidothioate |
| SMILES | C/N=C(\N)SCCCc1cn(C2=C(n3ccc4ccccc43)C(=O)NC2=O)c2ccccc12 |
| InChI | InChI=1S/C25H23N5O2S/c1-27-25(26)33-14-6-8-17-15-30(20-11-5-3-9-18(17)20)22-21(23(31)28-24(22)32)29-13-12-16-7-2-4-10-19(16)29/h2-5,7,9-13,15H,6,8,14H2,1H3,(H2,26,27)(H,28,31,32) |
| InChIKey | CKSIVMRJTBWJAP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 94.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|