C28H28N6O2S — CID 123202546
3-[3-[4-[1-(1-methylaziridin-2-yl)indol-3-yl]-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl N'-methylcarbamimidothioate (PubChem CID 123202546) has the molecular formula C28H28N6O2S and a molecular weight of 512.64 g/mol. Its IUPAC name is 3-[3-[4-[1-(1-methylaziridin-2-yl)indol-3-yl]-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl N'-methylcarbamimidothioate.
| Compound Name | 3-[3-[4-[1-(1-methylaziridin-2-yl)indol-3-yl]-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl N'-methylcarbamimidothioate |
|---|---|
| PubChem CID | 123202546 |
| Molecular Formula | C28H28N6O2S |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | 3-[3-[4-[1-(1-methylaziridin-2-yl)indol-3-yl]-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl N'-methylcarbamimidothioate |
| SMILES | C/N=C(\N)SCCCn1cc(C2=C(c3cn(C4CN4C)c4ccccc34)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C28H28N6O2S/c1-30-28(29)37-13-7-12-33-14-19(17-8-3-5-10-21(17)33)24-25(27(36)31-26(24)35)20-15-34(23-16-32(23)2)22-11-6-4-9-18(20)22/h3-6,8-11,14-15,23H,7,12-13,16H2,1-2H3,(H2,29,30)(H,31,35,36) |
| InChIKey | MFZRHJFIWAKJQU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|