C26H24N4O4 — CID 67630263
3-[1-[(2S,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]indol-3-yl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione (PubChem CID 67630263) has the molecular formula C26H24N4O4 and a molecular weight of 456.50 g/mol. Its IUPAC name is 3-[1-[(2S,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]indol-3-yl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-[(2S,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]indol-3-yl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67630263 |
| Molecular Formula | C26H24N4O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 3-[1-[(2S,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]indol-3-yl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
| SMILES | Cn1cc(C2=C(c3cn([C@@H]4C[C@H](N)[C@@H](CO)O4)c4ccccc34)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C26H24N4O4/c1-29-11-16(14-6-2-4-8-19(14)29)23-24(26(33)28-25(23)32)17-12-30(20-9-5-3-7-15(17)20)22-10-18(27)21(13-31)34-22/h2-9,11-12,18,21-22,31H,10,13,27H2,1H3,(H,28,32,33)/t18-,21+,22-/m0/s1 |
| InChIKey | WTECFCHJCNZHSE-BWAGFHJFSA-N |
| XLogP | 2.31 |
| TPSA | 111.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|