C16H14N2O — CID 139602376
1-(2-phenylethyl)-1,5-naphthyridin-2-one (PubChem CID 139602376) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is 1-(2-phenylethyl)-1,5-naphthyridin-2-one.
| Compound Name | 1-(2-phenylethyl)-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 139602376 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-(2-phenylethyl)-1,5-naphthyridin-2-one |
| SMILES | O=c1ccc2ncccc2n1CCc1ccccc1 |
| InChI | InChI=1S/C16H14N2O/c19-16-9-8-14-15(7-4-11-17-14)18(16)12-10-13-5-2-1-3-6-13/h1-9,11H,10,12H2 |
| InChIKey | RXNXUHZFMHFWSQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |