C20H20N2O2 — CID 139602407
1-cyclopropyl-3-(4-propoxyphenyl)-1,8-naphthyridin-2-one (PubChem CID 139602407) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-cyclopropyl-3-(4-propoxyphenyl)-1,8-naphthyridin-2-one.
| Compound Name | 1-cyclopropyl-3-(4-propoxyphenyl)-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 139602407 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-cyclopropyl-3-(4-propoxyphenyl)-1,8-naphthyridin-2-one |
| SMILES | CCCOc1ccc(-c2cc3cccnc3n(C3CC3)c2=O)cc1 |
| InChI | InChI=1S/C20H20N2O2/c1-2-12-24-17-9-5-14(6-10-17)18-13-15-4-3-11-21-19(15)22(20(18)23)16-7-8-16/h3-6,9-11,13,16H,2,7-8,12H2,1H3 |
| InChIKey | GAYGEXRCUXCINX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |