C14H16N2O — CID 139602622
5-methyl-1-pent-2-enyl-1,8-naphthyridin-2-one (PubChem CID 139602622) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is 5-methyl-1-pent-2-enyl-1,8-naphthyridin-2-one.
| Compound Name | 5-methyl-1-pent-2-enyl-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 139602622 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 5-methyl-1-pent-2-enyl-1,8-naphthyridin-2-one |
| SMILES | CCC=CCn1c(=O)ccc2c(C)ccnc21 |
| InChI | InChI=1S/C14H16N2O/c1-3-4-5-10-16-13(17)7-6-12-11(2)8-9-15-14(12)16/h4-9H,3,10H2,1-2H3 |
| InChIKey | XXJBFMGPMRNUML-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|