C11H17N3 — CID 162761081
ethane;1-ethyl-4-methylpyrazolo[3,4-b]pyridine (PubChem CID 162761081) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is ethane;1-ethyl-4-methylpyrazolo[3,4-b]pyridine.
| Compound Name | ethane;1-ethyl-4-methylpyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 162761081 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | ethane;1-ethyl-4-methylpyrazolo[3,4-b]pyridine |
| SMILES | CC.CCn1ncc2c(C)ccnc21 |
| InChI | InChI=1S/C9H11N3.C2H6/c1-3-12-9-8(6-11-12)7(2)4-5-10-9;1-2/h4-6H,3H2,1-2H3;1-2H3 |
| InChIKey | FLDGCTKHPUZSAS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |