About 1-(2-methylpropyl)pyrazolo[3,4-b]pyridin-4-amine
1-(2-methylpropyl)pyrazolo[3,4-b]pyridin-4-amine (PubChem CID 112580883) has the molecular formula C10H14N4
and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-(2-methylpropyl)pyrazolo[3,4-b]pyridin-4-amine.
Molecular Properties
| Compound Name | 1-(2-methylpropyl)pyrazolo[3,4-b]pyridin-4-amine |
| PubChem CID | 112580883 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1-(2-methylpropyl)pyrazolo[3,4-b]pyridin-4-amine |
| SMILES | CC(C)Cn1ncc2c(N)ccnc21 |
| InChI | InChI=1S/C10H14N4/c1-7(2)6-14-10-8(5-13-14)9(11)3-4-12-10/h3-5,7H,6H2,1-2H3,(H2,11,12) |
| InChIKey | WLMCNRMUFYFGRA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-methylpropyl)pyrazolo[3,4-b]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylpropyl)pyrazolo[3,4-b]pyridin-4-amine?
The IUPAC name of 1-(2-methylpropyl)pyrazolo[3,4-b]pyridin-4-amine (CID 112580883) is 1-(2-methylpropyl)pyrazolo[3,4-b]pyridin-4-amine.
What is the SMILES notation for 1-(2-methylpropyl)pyrazolo[3,4-b]pyridin-4-amine?
The canonical SMILES for 1-(2-methylpropyl)pyrazolo[3,4-b]pyridin-4-amine is CC(C)Cn1ncc2c(N)ccnc21.
What is the InChIKey of 1-(2-methylpropyl)pyrazolo[3,4-b]pyridin-4-amine?
The InChIKey is WLMCNRMUFYFGRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4/c1-7(2)6-14-10-8(5-13-14)9(11)3-4-12-10/h3-5,7H,6H2,1-2H3,(H2,11,12).
What are the key properties of 1-(2-methylpropyl)pyrazolo[3,4-b]pyridin-4-amine?
1-(2-methylpropyl)pyrazolo[3,4-b]pyridin-4-amine has a molecular weight of 190.25 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylpropyl)pyrazolo[3,4-b]pyridin-4-amine is sourced from PubChem (CID 112580883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).