C26H35NO4Si — CID 139603457
(3S,4S)-1-[tert-butyl(dimethyl)silyl]-4-[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]-3-[(1S)-1-hydroxyethyl]azetidin-2-one (PubChem CID 139603457) has the molecular formula C26H35NO4Si and a molecular weight of 453.66 g/mol. Its IUPAC name is (3S,4S)-1-[tert-butyl(dimethyl)silyl]-4-[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]-3-[(1S)-1-hydroxyethyl]azetidin-2-one.
| Compound Name | (3S,4S)-1-[tert-butyl(dimethyl)silyl]-4-[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]-3-[(1S)-1-hydroxyethyl]azetidin-2-one |
|---|---|
| PubChem CID | 139603457 |
| Molecular Formula | C26H35NO4Si |
| Molecular Weight | 453.66 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | (3S,4S)-1-[tert-butyl(dimethyl)silyl]-4-[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]-3-[(1S)-1-hydroxyethyl]azetidin-2-one |
| SMILES | C[C@H](O)[C@H]1C(=O)N([Si](C)(C)C(C)(C)C)[C@@H]1[C@H]1COC(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C26H35NO4Si/c1-18(28)22-23(27(24(22)29)32(5,6)25(2,3)4)21-17-30-26(31-21,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,18,21-23,28H,17H2,1-6H3/t18-,21+,22+,23+/m0/s1 |
| InChIKey | RCYHNDYJGZTKDM-JBJBFBLISA-N |
| XLogP | 4.52 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.66 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|