C17H20O5 — CID 139605031
cis-(1S,3S)-3-(3-ethoxy-3-oxo-2-phenoxyprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 139605031) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is cis-(1S,3S)-3-(3-ethoxy-3-oxo-2-phenoxyprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | cis-(1S,3S)-3-(3-ethoxy-3-oxo-2-phenoxyprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 139605031 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | cis-(1S,3S)-3-(3-ethoxy-3-oxo-2-phenoxyprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CCOC(=O)C(=C[C@H]1[C@H](C(=O)O)C1(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C17H20O5/c1-4-21-16(20)13(22-11-8-6-5-7-9-11)10-12-14(15(18)19)17(12,2)3/h5-10,12,14H,4H2,1-3H3,(H,18,19)/t12-,14+/m0/s1 |
| InChIKey | JADPLBPOXAFIQR-GXTWGEPZSA-N |
| XLogP | 2.87 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|