C17H20N6O2S — CID 139606315
2-[7-amino-2-(furan-2-yl)pyrazolo[1,5-a][1,3,5]triazin-4-yl]sulfanyl-N-cyclohexylacetamide (PubChem CID 139606315) has the molecular formula C17H20N6O2S and a molecular weight of 372.45 g/mol. Its IUPAC name is 2-[7-amino-2-(furan-2-yl)pyrazolo[1,5-a][1,3,5]triazin-4-yl]sulfanyl-N-cyclohexylacetamide.
| Compound Name | 2-[7-amino-2-(furan-2-yl)pyrazolo[1,5-a][1,3,5]triazin-4-yl]sulfanyl-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 139606315 |
| Molecular Formula | C17H20N6O2S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2-[7-amino-2-(furan-2-yl)pyrazolo[1,5-a][1,3,5]triazin-4-yl]sulfanyl-N-cyclohexylacetamide |
| SMILES | Nc1cc2nc(-c3ccco3)nc(SCC(=O)NC3CCCCC3)n2n1 |
| InChI | InChI=1S/C17H20N6O2S/c18-13-9-14-20-16(12-7-4-8-25-12)21-17(23(14)22-13)26-10-15(24)19-11-5-2-1-3-6-11/h4,7-9,11H,1-3,5-6,10H2,(H2,18,22)(H,19,24) |
| InChIKey | GKINAEVMJYHFRS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 111.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_pyridine_A(1)', 'substructure': 'N/A'} |
|---|