C25H35NOSSi — CID 139606653
1-[6-(2-hexyl-1,3-thiazol-5-yl)naphthalen-2-yl]oxypropyl-trimethylsilane (PubChem CID 139606653) has the molecular formula C25H35NOSSi and a molecular weight of 425.71 g/mol. Its IUPAC name is 1-[6-(2-hexyl-1,3-thiazol-5-yl)naphthalen-2-yl]oxypropyl-trimethylsilane.
| Compound Name | 1-[6-(2-hexyl-1,3-thiazol-5-yl)naphthalen-2-yl]oxypropyl-trimethylsilane |
|---|---|
| PubChem CID | 139606653 |
| Molecular Formula | C25H35NOSSi |
| Molecular Weight | 425.71 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 1-[6-(2-hexyl-1,3-thiazol-5-yl)naphthalen-2-yl]oxypropyl-trimethylsilane |
| SMILES | CCCCCCc1ncc(-c2ccc3cc(OC(CC)[Si](C)(C)C)ccc3c2)s1 |
| InChI | InChI=1S/C25H35NOSSi/c1-6-8-9-10-11-24-26-18-23(28-24)21-13-12-20-17-22(15-14-19(20)16-21)27-25(7-2)29(3,4)5/h12-18,25H,6-11H2,1-5H3 |
| InChIKey | BMXDFGXUOIJZHC-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.71 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|