C16H24O2 — CID 139607830
4-[(3R,5S)-5-hexyloxolan-3-yl]phenol (PubChem CID 139607830) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 4-[(3R,5S)-5-hexyloxolan-3-yl]phenol.
| Compound Name | 4-[(3R,5S)-5-hexyloxolan-3-yl]phenol |
|---|---|
| PubChem CID | 139607830 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 4-[(3R,5S)-5-hexyloxolan-3-yl]phenol |
| SMILES | CCCCCC[C@H]1C[C@H](c2ccc(O)cc2)CO1 |
| InChI | InChI=1S/C16H24O2/c1-2-3-4-5-6-16-11-14(12-18-16)13-7-9-15(17)10-8-13/h7-10,14,16-17H,2-6,11-12H2,1H3/t14-,16-/m0/s1 |
| InChIKey | ANTHXPPVUFANRG-HOCLYGCPSA-N |
| XLogP | 4.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|