About tributyl-[[(2R,4S)-4-phenyloxolan-2-yl]methyl]germane
tributyl-[[(2R,4S)-4-phenyloxolan-2-yl]methyl]germane (PubChem CID 101215706) has the molecular formula C23H40GeO
and a molecular weight of 405.18 g/mol. Its IUPAC name is tributyl-[[(2R,4S)-4-phenyloxolan-2-yl]methyl]germane.
Molecular Properties
| Compound Name | tributyl-[[(2R,4S)-4-phenyloxolan-2-yl]methyl]germane |
| PubChem CID | 101215706 |
| Molecular Formula | C23H40GeO |
| Molecular Weight | 405.18 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | tributyl-[[(2R,4S)-4-phenyloxolan-2-yl]methyl]germane |
| SMILES | CCCC[Ge](CCCC)(CCCC)C[C@H]1C[C@@H](c2ccccc2)CO1 |
| InChI | InChI=1S/C23H40GeO/c1-4-7-15-24(16-8-5-2,17-9-6-3)19-23-18-22(20-25-23)21-13-11-10-12-14-21/h10-14,22-23H,4-9,15-20H2,1-3H3/t22-,23-/m1/s1 |
| InChIKey | STIXAISWWHBPEF-DHIUTWEWSA-N |
| XLogP | 7.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.18 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze tributyl-[[(2R,4S)-4-phenyloxolan-2-yl]methyl]germane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-[[(2R,4S)-4-phenyloxolan-2-yl]methyl]germane?
The IUPAC name of tributyl-[[(2R,4S)-4-phenyloxolan-2-yl]methyl]germane (CID 101215706) is tributyl-[[(2R,4S)-4-phenyloxolan-2-yl]methyl]germane.
What is the SMILES notation for tributyl-[[(2R,4S)-4-phenyloxolan-2-yl]methyl]germane?
The canonical SMILES for tributyl-[[(2R,4S)-4-phenyloxolan-2-yl]methyl]germane is CCCC[Ge](CCCC)(CCCC)C[C@H]1C[C@@H](c2ccccc2)CO1.
What is the InChIKey of tributyl-[[(2R,4S)-4-phenyloxolan-2-yl]methyl]germane?
The InChIKey is STIXAISWWHBPEF-DHIUTWEWSA-N. The full InChI is InChI=1S/C23H40GeO/c1-4-7-15-24(16-8-5-2,17-9-6-3)19-23-18-22(20-25-23)21-13-11-10-12-14-21/h10-14,22-23H,4-9,15-20H2,1-3H3/t22-,23-/m1/s1.
What are the key properties of tributyl-[[(2R,4S)-4-phenyloxolan-2-yl]methyl]germane?
tributyl-[[(2R,4S)-4-phenyloxolan-2-yl]methyl]germane has a molecular weight of 405.18 g/mol, XLogP of 7.41, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-[[(2R,4S)-4-phenyloxolan-2-yl]methyl]germane is sourced from PubChem (CID 101215706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).