4,4-bis(2-aminophenyl)butanoic acid

C16H18N2O2 — CID 139607855

IUPAC4,4-bis(2-aminophenyl)butanoic acid
SMILESNc1ccccc1C(CCC(=O)O)c1ccccc1N
InChIInChI=1S/C16H18N2O2/c17-14-7-3-1-5-12(14)11(9-10-16(19)20)13-6-2-4-8-15(13)18/h1-8,11H,9-10,17-18H2,(H,19,20)
InChIKeyNAJDBDZAYHSBOL-UHFFFAOYSA-N
MW270.33 g/mol
LogP2.85
Rot. Bonds5

About 4,4-bis(2-aminophenyl)butanoic acid

4,4-bis(2-aminophenyl)butanoic acid (PubChem CID 139607855) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 4,4-bis(2-aminophenyl)butanoic acid.

Molecular Properties

Compound Name4,4-bis(2-aminophenyl)butanoic acid
PubChem CID139607855
Molecular FormulaC16H18N2O2
Molecular Weight270.33 g/mol
Exact Mass270.14
IUPAC Name4,4-bis(2-aminophenyl)butanoic acid
SMILESNc1ccccc1C(CCC(=O)O)c1ccccc1N
InChIInChI=1S/C16H18N2O2/c17-14-7-3-1-5-12(14)11(9-10-16(19)20)13-6-2-4-8-15(13)18/h1-8,11H,9-10,17-18H2,(H,19,20)
InChIKeyNAJDBDZAYHSBOL-UHFFFAOYSA-N
XLogP2.85
TPSA89.34 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.33
LogP ≤ 52.85
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 4,4-bis(2-aminophenyl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,4-bis(2-aminophenyl)butanoic acid?
The IUPAC name of 4,4-bis(2-aminophenyl)butanoic acid (CID 139607855) is 4,4-bis(2-aminophenyl)butanoic acid.
What is the SMILES notation for 4,4-bis(2-aminophenyl)butanoic acid?
The canonical SMILES for 4,4-bis(2-aminophenyl)butanoic acid is Nc1ccccc1C(CCC(=O)O)c1ccccc1N.
What is the InChIKey of 4,4-bis(2-aminophenyl)butanoic acid?
The InChIKey is NAJDBDZAYHSBOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2/c17-14-7-3-1-5-12(14)11(9-10-16(19)20)13-6-2-4-8-15(13)18/h1-8,11H,9-10,17-18H2,(H,19,20).
What are the key properties of 4,4-bis(2-aminophenyl)butanoic acid?
4,4-bis(2-aminophenyl)butanoic acid has a molecular weight of 270.33 g/mol, XLogP of 2.85, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-bis(2-aminophenyl)butanoic acid is sourced from PubChem (CID 139607855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).