C14H17F3O3S — CID 139612420
[3,3,3-trifluoro-2-hydroxy-1-(4-methylphenyl)sulfanylpropyl] 2-methylpropanoate (PubChem CID 139612420) has the molecular formula C14H17F3O3S and a molecular weight of 322.35 g/mol. Its IUPAC name is [3,3,3-trifluoro-2-hydroxy-1-(4-methylphenyl)sulfanylpropyl] 2-methylpropanoate.
| Compound Name | [3,3,3-trifluoro-2-hydroxy-1-(4-methylphenyl)sulfanylpropyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 139612420 |
| Molecular Formula | C14H17F3O3S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | [3,3,3-trifluoro-2-hydroxy-1-(4-methylphenyl)sulfanylpropyl] 2-methylpropanoate |
| SMILES | Cc1ccc(SC(OC(=O)C(C)C)C(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3O3S/c1-8(2)12(19)20-13(11(18)14(15,16)17)21-10-6-4-9(3)5-7-10/h4-8,11,13,18H,1-3H3 |
| InChIKey | ZDYPPBHXQKYHPZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|