C12H13F3O3S — CID 139612422
[3,3,3-trifluoro-2-hydroxy-1-(4-methylphenyl)sulfanylpropyl] acetate (PubChem CID 139612422) has the molecular formula C12H13F3O3S and a molecular weight of 294.29 g/mol. Its IUPAC name is [3,3,3-trifluoro-2-hydroxy-1-(4-methylphenyl)sulfanylpropyl] acetate.
| Compound Name | [3,3,3-trifluoro-2-hydroxy-1-(4-methylphenyl)sulfanylpropyl] acetate |
|---|---|
| PubChem CID | 139612422 |
| Molecular Formula | C12H13F3O3S |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | [3,3,3-trifluoro-2-hydroxy-1-(4-methylphenyl)sulfanylpropyl] acetate |
| SMILES | CC(=O)OC(Sc1ccc(C)cc1)C(O)C(F)(F)F |
| InChI | InChI=1S/C12H13F3O3S/c1-7-3-5-9(6-4-7)19-11(18-8(2)16)10(17)12(13,14)15/h3-6,10-11,17H,1-2H3 |
| InChIKey | WDYIPLVBWLZDRS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|