C24H32N2O2S — CID 139612739
N-[[(3S)-2-butyl-7-methoxy-3,4-dihydro-1H-isoquinolin-3-yl]methyl]-2-methoxy-5-methylbenzenecarbothioamide (PubChem CID 139612739) has the molecular formula C24H32N2O2S and a molecular weight of 412.60 g/mol. Its IUPAC name is N-[[(3S)-2-butyl-7-methoxy-3,4-dihydro-1H-isoquinolin-3-yl]methyl]-2-methoxy-5-methylbenzenecarbothioamide.
| Compound Name | N-[[(3S)-2-butyl-7-methoxy-3,4-dihydro-1H-isoquinolin-3-yl]methyl]-2-methoxy-5-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 139612739 |
| Molecular Formula | C24H32N2O2S |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | N-[[(3S)-2-butyl-7-methoxy-3,4-dihydro-1H-isoquinolin-3-yl]methyl]-2-methoxy-5-methylbenzenecarbothioamide |
| SMILES | CCCCN1Cc2cc(OC)ccc2C[C@H]1CNC(=S)c1cc(C)ccc1OC |
| InChI | InChI=1S/C24H32N2O2S/c1-5-6-11-26-16-19-14-21(27-3)9-8-18(19)13-20(26)15-25-24(29)22-12-17(2)7-10-23(22)28-4/h7-10,12,14,20H,5-6,11,13,15-16H2,1-4H3,(H,25,29)/t20-/m0/s1 |
| InChIKey | VLEHDHJXEORBAT-FQEVSTJZSA-N |
| XLogP | 4.50 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|