C30H40N2O6 — CID 139615734
[(3S)-oxolan-3-yl] N-[(4S,5S,7R)-7-benzyl-5-hydroxy-8-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-methyl-8-oxooctan-4-yl]carbamate (PubChem CID 139615734) has the molecular formula C30H40N2O6 and a molecular weight of 524.66 g/mol. Its IUPAC name is [(3S)-oxolan-3-yl] N-[(4S,5S,7R)-7-benzyl-5-hydroxy-8-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-methyl-8-oxooctan-4-yl]carbamate.
| Compound Name | [(3S)-oxolan-3-yl] N-[(4S,5S,7R)-7-benzyl-5-hydroxy-8-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-methyl-8-oxooctan-4-yl]carbamate |
|---|---|
| PubChem CID | 139615734 |
| Molecular Formula | C30H40N2O6 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | [(3S)-oxolan-3-yl] N-[(4S,5S,7R)-7-benzyl-5-hydroxy-8-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-methyl-8-oxooctan-4-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)O[C@H]1CCOC1)[C@@H](O)C[C@@H](Cc1ccccc1)C(=O)N[C@H]1c2ccccc2C[C@H]1O |
| InChI | InChI=1S/C30H40N2O6/c1-19(2)14-25(31-30(36)38-23-12-13-37-18-23)26(33)17-22(15-20-8-4-3-5-9-20)29(35)32-28-24-11-7-6-10-21(24)16-27(28)34/h3-11,19,22-23,25-28,33-34H,12-18H2,1-2H3,(H,31,36)(H,32,35)/t22-,23+,25+,26+,27-,28+/m1/s1 |
| InChIKey | JXAPOTLWZVDLMR-VZPCWAAESA-N |
| XLogP | 3.30 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |